C18H23N8O4P — CID 59646348
(E)-N-[2-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]-3-(1H-imidazol-5-yl)prop-2-enamide (PubChem CID 59646348) has the molecular formula C18H23N8O4P and a molecular weight of 448.42 g/mol. Its IUPAC name is (E)-N-[2-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]-3-(1H-imidazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]-3-(1H-imidazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 59646348 |
| Molecular Formula | C18H23N8O4P |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (E)-N-[2-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]-3-(1H-imidazol-5-yl)prop-2-enamide |
| SMILES | [3H]POCC1OC(n2cnc3c(NCCNC(=O)/C=C/c4cnc[nH]4)ncnc32)CC1O |
| InChI | InChI=1S/C18H23N8O4P/c27-12-5-15(30-13(12)7-29-31)26-10-25-16-17(23-9-24-18(16)26)21-4-3-20-14(28)2-1-11-6-19-8-22-11/h1-2,6,8-10,12-13,15,27H,3-5,7,31H2,(H,19,22)(H,20,28)(H,21,23,24)/b2-1+/i31T |
| InChIKey | KOOVLMZGWIDCQR-GCXGZXASSA-N |
| XLogP | 0.25 |
| TPSA | 152.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|