C16H18N8O4P+ — CID 58672703
[5-[6-amino-8-[[(E)-3-(1H-imidazol-5-yl)prop-2-enoyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl-oxo-tritiophosphanium (PubChem CID 58672703) has the molecular formula C16H18N8O4P+ and a molecular weight of 419.35 g/mol. Its IUPAC name is [5-[6-amino-8-[[(E)-3-(1H-imidazol-5-yl)prop-2-enoyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl-oxo-tritiophosphanium.
| Compound Name | [5-[6-amino-8-[[(E)-3-(1H-imidazol-5-yl)prop-2-enoyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl-oxo-tritiophosphanium |
|---|---|
| PubChem CID | 58672703 |
| Molecular Formula | C16H18N8O4P+ |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [5-[6-amino-8-[[(E)-3-(1H-imidazol-5-yl)prop-2-enoyl]amino]purin-9-yl]-3-hydroxyoxolan-2-yl]methyl-oxo-tritiophosphanium |
| SMILES | [3H][P+](=O)CC1OC(n2c(NC(=O)/C=C/c3cnc[nH]3)nc3c(N)ncnc32)CC1O |
| InChI | InChI=1S/C16H17N8O4P/c17-14-13-15(21-7-20-14)24(12-3-9(25)10(28-12)5-29-27)16(23-13)22-11(26)2-1-8-4-18-6-19-8/h1-2,4,6-7,9-10,12,25H,3,5H2,(H,18,19)(H2,17,20,21)(H,22,23,26)/p+1/b2-1+/i/hT |
| InChIKey | HRKYVYDDUCPBBH-GMABKBBMSA-O |
| XLogP | 0.46 |
| TPSA | 173.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|