C18H18N6O5 — CID 175096849
5-[6-amino-8-[(E)-2-(4-nitrophenyl)ethenyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 175096849) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is 5-[6-amino-8-[(E)-2-(4-nitrophenyl)ethenyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 5-[6-amino-8-[(E)-2-(4-nitrophenyl)ethenyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 175096849 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5-[6-amino-8-[(E)-2-(4-nitrophenyl)ethenyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1nc(/C=C/c1ccc([N+](=O)[O-])cc1)n2C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C18H18N6O5/c19-17-16-18(21-9-20-17)23(15-7-12(26)13(8-25)29-15)14(22-16)6-3-10-1-4-11(5-2-10)24(27)28/h1-6,9,12-13,15,25-26H,7-8H2,(H2,19,20,21)/b6-3+ |
| InChIKey | KIIJYAXJEDIZHJ-ZZXKWVIFSA-N |
| XLogP | 1.13 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|