C17H16N6O6 — CID 54493531
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 54493531) has the molecular formula C17H16N6O6 and a molecular weight of 400.35 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 54493531 |
| Molecular Formula | C17H16N6O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COC(=O)c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C17H16N6O6/c18-15-14-16(20-7-19-15)22(8-21-14)13-5-11(24)12(29-13)6-28-17(25)9-1-3-10(4-2-9)23(26)27/h1-4,7-8,11-13,24H,5-6H2,(H2,18,19,20)/t11-,12+,13+/m0/s1 |
| InChIKey | XXLLQKLXHDHXNX-YNEHKIRRSA-N |
| XLogP | 0.82 |
| TPSA | 168.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|