C15H25N5O3SSi — CID 10833864
(2R,3S,5R)-5-[6-amino-8-(2-trimethylsilylethylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 10833864) has the molecular formula C15H25N5O3SSi and a molecular weight of 383.55 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-amino-8-(2-trimethylsilylethylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-amino-8-(2-trimethylsilylethylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10833864 |
| Molecular Formula | C15H25N5O3SSi |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (2R,3S,5R)-5-[6-amino-8-(2-trimethylsilylethylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C[Si](C)(C)CCSc1nc2c(N)ncnc2n1[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C15H25N5O3SSi/c1-25(2,3)5-4-24-15-19-12-13(16)17-8-18-14(12)20(15)11-6-9(22)10(7-21)23-11/h8-11,21-22H,4-7H2,1-3H3,(H2,16,17,18)/t9-,10+,11+/m0/s1 |
| InChIKey | QGLUQOIZHJOFLQ-HBNTYKKESA-N |
| XLogP | 1.48 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|