C16H25N5O3S2 — CID 89283247
(2R,5R)-5-[6-amino-8-(6-sulfanylhexylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 89283247) has the molecular formula C16H25N5O3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is (2R,5R)-5-[6-amino-8-(6-sulfanylhexylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5R)-5-[6-amino-8-(6-sulfanylhexylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 89283247 |
| Molecular Formula | C16H25N5O3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (2R,5R)-5-[6-amino-8-(6-sulfanylhexylsulfanyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1nc(SCCCCCCS)n2[C@H]1CC(O)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H25N5O3S2/c17-14-13-15(19-9-18-14)21(12-7-10(23)11(8-22)24-12)16(20-13)26-6-4-2-1-3-5-25/h9-12,22-23,25H,1-8H2,(H2,17,18,19)/t10?,11-,12-/m1/s1 |
| InChIKey | SVSZNYIGNSYYGB-PQDIPPBSSA-N |
| XLogP | 1.63 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|