C18H16N6O6 — CID 102178265
(2R,3R,4S,5R)-2-[6-amino-8-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 102178265) has the molecular formula C18H16N6O6 and a molecular weight of 412.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 102178265 |
| Molecular Formula | C18H16N6O6 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(C#Cc1ccc([N+](=O)[O-])cc1)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H16N6O6/c19-16-13-17(21-8-20-16)23(18-15(27)14(26)11(7-25)30-18)12(22-13)6-3-9-1-4-10(5-2-9)24(28)29/h1-2,4-5,8,11,14-15,18,25-27H,7H2,(H2,19,20,21)/t11-,14-,15-,18-/m1/s1 |
| InChIKey | ZVJHTMHWBZCHEY-XKLVTHTNSA-N |
| XLogP | -0.67 |
| TPSA | 182.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|