C18H21N5O4 — CID 175676889
(2R,3R,4S,5R)-2-(6-amino-8-octa-1,7-diynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 175676889) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-8-octa-1,7-diynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-8-octa-1,7-diynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 175676889 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-8-octa-1,7-diynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#CCCCCC#Cc1nc2c(N)ncnc2n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H21N5O4/c1-2-3-4-5-6-7-8-12-22-13-16(19)20-10-21-17(13)23(12)18-15(26)14(25)11(9-24)27-18/h1,10-11,14-15,18,24-26H,3-6,9H2,(H2,19,20,21)/t11-,14-,15-,18-/m1/s1 |
| InChIKey | RHJBPOVWJRBZAX-XKLVTHTNSA-N |
| XLogP | -0.43 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|