C19H16F3N5O4 — CID 11654999
(2R,3R,4S,5R)-2-[6-amino-8-[2-[4-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11654999) has the molecular formula C19H16F3N5O4 and a molecular weight of 435.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[2-[4-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[2-[4-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11654999 |
| Molecular Formula | C19H16F3N5O4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[2-[4-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(C#Cc1ccc(C(F)(F)F)cc1)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H16F3N5O4/c20-19(21,22)10-4-1-9(2-5-10)3-6-12-26-13-16(23)24-8-25-17(13)27(12)18-15(30)14(29)11(7-28)31-18/h1-2,4-5,8,11,14-15,18,28-30H,7H2,(H2,23,24,25)/t11-,14-,15-,18-/m1/s1 |
| InChIKey | SBGRWYLKZSXVRN-XKLVTHTNSA-N |
| XLogP | 0.44 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|