C20H19N7O6S — CID 46873903
(3R,4S,5R)-2-[3-amino-13-[(4-nitrophenyl)methylsulfanyl]-4,6,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46873903) has the molecular formula C20H19N7O6S and a molecular weight of 485.48 g/mol. Its IUPAC name is (3R,4S,5R)-2-[3-amino-13-[(4-nitrophenyl)methylsulfanyl]-4,6,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[3-amino-13-[(4-nitrophenyl)methylsulfanyl]-4,6,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46873903 |
| Molecular Formula | C20H19N7O6S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (3R,4S,5R)-2-[3-amino-13-[(4-nitrophenyl)methylsulfanyl]-4,6,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1c1c(SCc3ccc([N+](=O)[O-])cc3)ncnc1n2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H19N7O6S/c21-16-12-13-18(24-8-25-19(13)34-6-9-1-3-10(4-2-9)27(31)32)26(17(12)23-7-22-16)20-15(30)14(29)11(5-28)33-20/h1-4,7-8,11,14-15,20,28-30H,5-6H2,(H2,21,22,23)/t11-,14-,15-,20?/m1/s1 |
| InChIKey | RRQPBBIUAQIQTM-FLKUZKQZSA-N |
| XLogP | 0.77 |
| TPSA | 195.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|