C19H20N4O5S — CID 171816599
(2R,3S,4R,5R)-2-methyl-5-[5-methyl-4-[(4-nitrophenyl)methylsulfanyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 171816599) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-methyl-5-[5-methyl-4-[(4-nitrophenyl)methylsulfanyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-methyl-5-[5-methyl-4-[(4-nitrophenyl)methylsulfanyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 171816599 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-methyl-5-[5-methyl-4-[(4-nitrophenyl)methylsulfanyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | Cc1cn([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)c2ncnc(SCc3ccc([N+](=O)[O-])cc3)c12 |
| InChI | InChI=1S/C19H20N4O5S/c1-10-7-22(19-16(25)15(24)11(2)28-19)17-14(10)18(21-9-20-17)29-8-12-3-5-13(6-4-12)23(26)27/h3-7,9,11,15-16,19,24-25H,8H2,1-2H3/t11-,15-,16-,19-/m1/s1 |
| InChIKey | ZMTSMKORJDWYAK-LUTMRVPUSA-N |
| XLogP | 2.58 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|