C18H17N6O9P — CID 67534208
[(3R,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-nitrophenyl) hydrogen phosphate (PubChem CID 67534208) has the molecular formula C18H17N6O9P and a molecular weight of 492.34 g/mol. Its IUPAC name is [(3R,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-nitrophenyl) hydrogen phosphate.
| Compound Name | [(3R,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-nitrophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 67534208 |
| Molecular Formula | C18H17N6O9P |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | [(3R,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-nitrophenyl) hydrogen phosphate |
| SMILES | N#Cc1cn([C@@H]2OC(COP(=O)(O)Oc3ccc([N+](=O)[O-])cc3)[C@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C18H17N6O9P/c19-5-9-6-23(17-13(9)16(20)21-8-22-17)18-15(26)14(25)12(32-18)7-31-34(29,30)33-11-3-1-10(2-4-11)24(27)28/h1-4,6,8,12,14-15,18,25-26H,7H2,(H,29,30)(H2,20,21,22)/t12?,14-,15+,18+/m0/s1 |
| InChIKey | YLVPRJOAMOWWLZ-UIRRPCRCSA-N |
| XLogP | 0.61 |
| TPSA | 229.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|