C15H19N4O13P3S — CID 118282949
[[(2R,4S,5R)-5-(4-amino-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118282949) has the molecular formula C15H19N4O13P3S and a molecular weight of 588.32 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(4-amino-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-5-(4-amino-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118282949 |
| Molecular Formula | C15H19N4O13P3S |
| Molecular Weight | 588.32 g/mol |
| Exact Mass | 587.99 |
| IUPAC Name | [[(2R,4S,5R)-5-(4-amino-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1c(-c1cccs1)cn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]1O |
| InChI | InChI=1S/C15H19N4O13P3S/c16-13-10-7(9-2-1-3-36-9)4-19(14(10)18-6-17-13)15-12(21)11(20)8(30-15)5-29-34(25,26)32-35(27,28)31-33(22,23)24/h1-4,6,8,11-12,15,20-21H,5H2,(H,25,26)(H,27,28)(H2,16,17,18)(H2,22,23,24)/t8-,11?,12+,15-/m1/s1 |
| InChIKey | BAQIMKWFPNPGHF-VWYPAOBRSA-N |
| XLogP | 0.70 |
| TPSA | 266.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|