C21H21N4O13P3 — CID 174253222
[[(2R,5R)-3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174253222) has the molecular formula C21H21N4O13P3 and a molecular weight of 630.34 g/mol. Its IUPAC name is [[(2R,5R)-3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174253222 |
| Molecular Formula | C21H21N4O13P3 |
| Molecular Weight | 630.34 g/mol |
| Exact Mass | 630.03 |
| IUPAC Name | [[(2R,5R)-3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cc3c4c(ncnc42)Nc2cc4ccccc4cc2-3)C(O)C1O |
| InChI | InChI=1S/C21H21N4O13P3/c26-17-15(8-35-40(31,32)38-41(33,34)37-39(28,29)30)36-21(18(17)27)25-7-13-12-5-10-3-1-2-4-11(10)6-14(12)24-19-16(13)20(25)23-9-22-19/h1-7,9,15,17-18,21,26-27H,8H2,(H,31,32)(H,33,34)(H,22,23,24)(H2,28,29,30)/t15-,17?,18?,21-/m1/s1 |
| InChIKey | AGYAUJHKIHMKOO-BDROVNNXSA-N |
| XLogP | 2.27 |
| TPSA | 252.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|