C21H19N4O7P — CID 174253150
[3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 174253150) has the molecular formula C21H19N4O7P and a molecular weight of 470.38 g/mol. Its IUPAC name is [3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174253150 |
| Molecular Formula | C21H19N4O7P |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [3,4-dihydroxy-5-(12,14,16,18-tetrazapentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(19),2,4,6,8,10,13(20),14,16-nonaen-18-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCC1OC(n2cc3c4c(ncnc42)Nc2cc4ccccc4cc2-3)C(O)C1O |
| InChI | InChI=1S/C21H19N4O7P/c26-17-15(8-31-33(28,29)30)32-21(18(17)27)25-7-13-12-5-10-3-1-2-4-11(10)6-14(12)24-19-16(13)20(25)23-9-22-19/h1-7,9,15,17-18,21,26-27H,8H2,(H,22,23,24)(H2,28,29,30) |
| InChIKey | XEXOCEUVNCGWBA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|