C20H19N4O7P — CID 118205091
[(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-naphthalen-2-ylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 118205091) has the molecular formula C20H19N4O7P and a molecular weight of 458.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-naphthalen-2-ylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-naphthalen-2-ylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118205091 |
| Molecular Formula | C20H19N4O7P |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-naphthalen-2-ylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](n2cnc3c(-c4ccc5ccccc5c4)ncnc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H19N4O7P/c25-17-14(8-30-32(27,28)29)31-20(18(17)26)24-10-23-16-15(21-9-22-19(16)24)13-6-5-11-3-1-2-4-12(11)7-13/h1-7,9-10,14,17-18,20,25-26H,8H2,(H2,27,28,29)/t14-,17+,18-,20-/m1/s1 |
| InChIKey | LQGRESLLVHYRLI-GVZBARQTSA-N |
| XLogP | 1.38 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|