C19H23N4O7P — CID 73386715
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-propan-2-ylphenyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 73386715) has the molecular formula C19H23N4O7P and a molecular weight of 450.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-propan-2-ylphenyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-propan-2-ylphenyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 73386715 |
| Molecular Formula | C19H23N4O7P |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-propan-2-ylphenyl)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)c1cccc(-c2ncnc3c2ncn3[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C19H23N4O7P/c1-10(2)11-4-3-5-12(6-11)14-15-18(21-8-20-14)23(9-22-15)19-17(25)16(24)13(30-19)7-29-31(26,27)28/h3-6,8-10,13,16-17,19,24-25H,7H2,1-2H3,(H2,26,27,28)/t13-,16-,17-,19-/m1/s1 |
| InChIKey | VUUCBDXBFWTXIK-VVHMCBODSA-N |
| XLogP | 1.35 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|