C15H15N4Na2O8P — CID 122653853
disodium;[(2R,3S,4R,5R)-5-[4-amino-5-(furan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 122653853) has the molecular formula C15H15N4Na2O8P and a molecular weight of 456.26 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-5-[4-amino-5-(furan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-5-[4-amino-5-(furan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 122653853 |
| Molecular Formula | C15H15N4Na2O8P |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-5-[4-amino-5-(furan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | Nc1ncnc2c1c(-c1ccco1)cn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C15H17N4O8P.2Na/c16-13-10-7(8-2-1-3-25-8)4-19(14(10)18-6-17-13)15-12(21)11(20)9(27-15)5-26-28(22,23)24;;/h1-4,6,9,11-12,15,20-21H,5H2,(H2,16,17,18)(H2,22,23,24);;/q;2*+1/p-2/t9-,11-,12-,15-;;/m1../s1 |
| InChIKey | OEIBRZWSKIPHFW-DEHVKTTJSA-L |
| XLogP | -7.25 |
| TPSA | 191.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | -7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|