C11H16N5NaO9P2 — CID 74764864
sodium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-hydroxyphosphinate (PubChem CID 74764864) has the molecular formula C11H16N5NaO9P2 and a molecular weight of 447.21 g/mol. Its IUPAC name is sodium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-hydroxyphosphinate.
| Compound Name | sodium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 74764864 |
| Molecular Formula | C11H16N5NaO9P2 |
| Molecular Weight | 447.21 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | sodium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-hydroxyphosphinate |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)CP(=O)([O-])O)C(O)C1O.[Na+] |
| InChI | InChI=1S/C11H17N5O9P2.Na/c12-9-6-10(14-2-13-9)16(3-15-6)11-8(18)7(17)5(25-11)1-24-27(22,23)4-26(19,20)21;/h2-3,5,7-8,11,17-18H,1,4H2,(H,22,23)(H2,12,13,14)(H2,19,20,21);/q;+1/p-1 |
| InChIKey | RFGZKSPLJPHQMI-UHFFFAOYSA-M |
| XLogP | -5.26 |
| TPSA | 226.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.21 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|