C11H13FIN4O6P — CID 164929802
[(2R,3S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 164929802) has the molecular formula C11H13FIN4O6P and a molecular weight of 474.12 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 164929802 |
| Molecular Formula | C11H13FIN4O6P |
| Molecular Weight | 474.12 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1ncnc2c1c(I)cn2[C@@H]1O[C@H](COP(=O)(O)O)[C@H](O)C1F |
| InChI | InChI=1S/C11H13FIN4O6P/c12-7-8(18)5(2-22-24(19,20)21)23-11(7)17-1-4(13)6-9(14)15-3-16-10(6)17/h1,3,5,7-8,11,18H,2H2,(H2,14,15,16)(H2,19,20,21)/t5-,7?,8+,11-/m1/s1 |
| InChIKey | FZQOZHVKJWZHNF-DWVWSIQXSA-N |
| XLogP | 0.32 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.12 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|