C14H16FIN4O4S — CID 155745130
[(2R,3R,4S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] ethylsulfanylformate (PubChem CID 155745130) has the molecular formula C14H16FIN4O4S and a molecular weight of 482.28 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] ethylsulfanylformate.
| Compound Name | [(2R,3R,4S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] ethylsulfanylformate |
|---|---|
| PubChem CID | 155745130 |
| Molecular Formula | C14H16FIN4O4S |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] ethylsulfanylformate |
| SMILES | CCSC(=O)O[C@H]1[C@H](F)[C@H](n2cc(I)c3c(N)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C14H16FIN4O4S/c1-2-25-14(22)24-10-7(4-21)23-13(9(10)15)20-3-6(16)8-11(17)18-5-19-12(8)20/h3,5,7,9-10,13,21H,2,4H2,1H3,(H2,17,18,19)/t7-,9+,10-,13-/m1/s1 |
| InChIKey | HUSSQNVNPMCVFG-ISCDUZKHSA-N |
| XLogP | 2.10 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|