C19H17FIN7O4 — CID 175677660
N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide (PubChem CID 175677660) has the molecular formula C19H17FIN7O4 and a molecular weight of 553.29 g/mol. Its IUPAC name is N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide.
| Compound Name | N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 175677660 |
| Molecular Formula | C19H17FIN7O4 |
| Molecular Weight | 553.29 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
| SMILES | [N-]=[N+]=NCO[C@H]1[C@@H](F)[C@H](n2cc(I)c3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C19H17FIN7O4/c20-14-15(31-9-25-27-22)12(7-29)32-19(14)28-6-11(21)13-16(23-8-24-17(13)28)26-18(30)10-4-2-1-3-5-10/h1-6,8,12,14-15,19,29H,7,9H2,(H,23,24,26,30)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | XRHKJBYHKLQURK-QEPJRFBGSA-N |
| XLogP | 3.17 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|