C24H20F4N8O5 — CID 175677652
N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide (PubChem CID 175677652) has the molecular formula C24H20F4N8O5 and a molecular weight of 576.47 g/mol. Its IUPAC name is N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide.
| Compound Name | N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 175677652 |
| Molecular Formula | C24H20F4N8O5 |
| Molecular Weight | 576.47 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | N-[7-[(2R,3R,4R,5R)-4-(azidomethoxy)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
| SMILES | [N-]=[N+]=NCO[C@H]1[C@@H](F)[C@H](n2cc(C#CCNC(=O)C(F)(F)F)c3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C24H20F4N8O5/c25-17-18(40-12-33-35-29)15(10-37)41-22(17)36-9-14(7-4-8-30-23(39)24(26,27)28)16-19(31-11-32-20(16)36)34-21(38)13-5-2-1-3-6-13/h1-3,5-6,9,11,15,17-18,22,37H,8,10,12H2,(H,30,39)(H,31,32,34,38)/t15-,17-,18-,22-/m1/s1 |
| InChIKey | VTOOQUIMJUUZEQ-UVLLPENVSA-N |
| XLogP | 2.59 |
| TPSA | 176.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|