C19H23N4O13P3 — CID 25235379
[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(9,11,13,15-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2,4,6,10(17),11,13-heptaen-15-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 25235379) has the molecular formula C19H23N4O13P3 and a molecular weight of 608.33 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(9,11,13,15-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2,4,6,10(17),11,13-heptaen-15-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(9,11,13,15-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2,4,6,10(17),11,13-heptaen-15-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 25235379 |
| Molecular Formula | C19H23N4O13P3 |
| Molecular Weight | 608.33 g/mol |
| Exact Mass | 608.05 |
| IUPAC Name | [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(9,11,13,15-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2,4,6,10(17),11,13-heptaen-15-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc2c3c(ncnc31)NCc1ccccc1-2 |
| InChI | InChI=1S/C19H23N4O13P3/c1-19(25)15(24)13(8-33-38(29,30)36-39(31,32)35-37(26,27)28)34-18(19)23-7-12-11-5-3-2-4-10(11)6-20-16-14(12)17(23)22-9-21-16/h2-5,7,9,13,15,18,24-25H,6,8H2,1H3,(H,29,30)(H,31,32)(H,20,21,22)(H2,26,27,28)/t13-,15-,18-,19-/m1/s1 |
| InChIKey | XINMJJMVDMGEBG-SVYNMNNPSA-N |
| XLogP | 1.38 |
| TPSA | 252.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|