C16H21N4O14P3 — CID 135435775
[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(12-methyl-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135435775) has the molecular formula C16H21N4O14P3 and a molecular weight of 586.28 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(12-methyl-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(12-methyl-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135435775 |
| Molecular Formula | C16H21N4O14P3 |
| Molecular Weight | 586.28 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(12-methyl-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cc(=O)nc2c3c(n([C@@H]4O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]4(C)O)cc13)N=CN2 |
| InChI | InChI=1S/C16H21N4O14P3/c1-7-3-10(21)19-13-11-8(7)4-20(14(11)18-6-17-13)15-16(2,23)12(22)9(32-15)5-31-36(27,28)34-37(29,30)33-35(24,25)26/h3-4,6,9,12,15,22-23H,5H2,1-2H3,(H,27,28)(H,29,30)(H2,24,25,26)(H,17,18,19,21)/t9-,12-,15-,16-/m1/s1 |
| InChIKey | CRXKIDPIIRQOSZ-KHTZZEJVSA-N |
| XLogP | 0.14 |
| TPSA | 268.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|