C16H22N5O14P3 — CID 135451483
[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-[12-(methylamino)-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135451483) has the molecular formula C16H22N5O14P3 and a molecular weight of 601.29 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-[12-(methylamino)-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-[12-(methylamino)-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135451483 |
| Molecular Formula | C16H22N5O14P3 |
| Molecular Weight | 601.29 g/mol |
| Exact Mass | 601.04 |
| IUPAC Name | [[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-[12-(methylamino)-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CNc1cc(=O)nc2c3c(n([C@@H]4O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]4(C)O)cc13)N=CN2 |
| InChI | InChI=1S/C16H22N5O14P3/c1-16(24)12(23)9(5-32-37(28,29)35-38(30,31)34-36(25,26)27)33-15(16)21-4-7-8(17-2)3-10(22)20-13-11(7)14(21)19-6-18-13/h3-4,6,9,12,15,17,23-24H,5H2,1-2H3,(H,28,29)(H,30,31)(H2,25,26,27)(H,18,19,20,22)/t9-,12-,15-,16-/m1/s1 |
| InChIKey | OUUDUCWXKJAGID-KHTZZEJVSA-N |
| XLogP | -0.12 |
| TPSA | 280.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|