C15H18FN4O14P3 — CID 135451486
[[(2R,3R,4R,5R)-5-(12-fluoro-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135451486) has the molecular formula C15H18FN4O14P3 and a molecular weight of 590.24 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(12-fluoro-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(12-fluoro-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135451486 |
| Molecular Formula | C15H18FN4O14P3 |
| Molecular Weight | 590.24 g/mol |
| Exact Mass | 590.00 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(12-fluoro-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc2c(F)cc(=O)nc3c2c1N=CN3 |
| InChI | InChI=1S/C15H18FN4O14P3/c1-15(23)11(22)8(4-31-36(27,28)34-37(29,30)33-35(24,25)26)32-14(15)20-3-6-7(16)2-9(21)19-12-10(6)13(20)18-5-17-12/h2-3,5,8,11,14,22-23H,4H2,1H3,(H,27,28)(H,29,30)(H2,24,25,26)(H,17,18,19,21)/t8-,11-,14-,15-/m1/s1 |
| InChIKey | NSZGCCIJGZZVIO-ZCLWBALQSA-N |
| XLogP | -0.03 |
| TPSA | 268.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|