C10H16N2O12P2 — CID 71346355
[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 71346355) has the molecular formula C10H16N2O12P2 and a molecular weight of 418.19 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 71346355 |
| Molecular Formula | C10H16N2O12P2 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CC1(O)C(O)C(COP(=O)(O)OP(=O)(O)O)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N2O12P2/c1-10(16)7(14)5(4-22-26(20,21)24-25(17,18)19)23-8(10)12-3-2-6(13)11-9(12)15/h2-3,5,7-8,14,16H,4H2,1H3,(H,20,21)(H,11,13,15)(H2,17,18,19) |
| InChIKey | LFWWNDZBFDONAW-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|