C12H15N2O12P3 — CID 89095830
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphoroso hydrogen phosphate (PubChem CID 89095830) has the molecular formula C12H15N2O12P3 and a molecular weight of 472.18 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphoroso hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphoroso hydrogen phosphate |
|---|---|
| PubChem CID | 89095830 |
| Molecular Formula | C12H15N2O12P3 |
| Molecular Weight | 472.18 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphoroso hydrogen phosphate |
| SMILES | C#C[C@]1(C)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H15N2O12P3/c1-3-12(2)9(16)7(6-23-28(19,20)26-29(21,22)25-27-18)24-10(12)14-5-4-8(15)13-11(14)17/h1,4-5,7,9-10,16H,6H2,2H3,(H,19,20)(H,21,22)(H,13,15,17)/t7-,9-,10-,12-/m1/s1 |
| InChIKey | ATUUHMJJSRHWKA-UGKPPGOTSA-N |
| XLogP | -0.11 |
| TPSA | 203.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|