C13H12N6O3S — CID 11724306
4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(isothiocyanatomethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 11724306) has the molecular formula C13H12N6O3S and a molecular weight of 332.35 g/mol. Its IUPAC name is 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(isothiocyanatomethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(isothiocyanatomethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 11724306 |
| Molecular Formula | C13H12N6O3S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(isothiocyanatomethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn([C@@H]2O[C@H](CN=C=S)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C13H12N6O3S/c14-1-6-3-19(12-8(6)11(15)17-4-18-12)13-10(21)9(20)7(22-13)2-16-5-23/h3-4,7,9-10,13,20-21H,2H2,(H2,15,17,18)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | WMTRHHBTDGDFPM-QYVSTXNMSA-N |
| XLogP | -0.39 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|