C12H12N5O6P — CID 53463477
4-amino-7-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 53463477) has the molecular formula C12H12N5O6P and a molecular weight of 353.23 g/mol. Its IUPAC name is 4-amino-7-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-7-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 53463477 |
| Molecular Formula | C12H12N5O6P |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-amino-7-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(C2OC3COP(=O)(O)OC3C2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H12N5O6P/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-8(18)9-6(22-12)3-21-24(19,20)23-9/h2,4,6,8-9,12,18H,3H2,(H,19,20)(H2,14,15,16) |
| InChIKey | WCXYPZXNWAXKGR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|