C9H13N4O7P — CID 171320718
5-amino-3-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)imidazole-4-carboxamide (PubChem CID 171320718) has the molecular formula C9H13N4O7P and a molecular weight of 320.20 g/mol. Its IUPAC name is 5-amino-3-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)imidazole-4-carboxamide.
| Compound Name | 5-amino-3-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 171320718 |
| Molecular Formula | C9H13N4O7P |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-amino-3-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)imidazole-4-carboxamide |
| SMILES | NC(=O)c1c(N)ncn1C1OC2COP(=O)(O)OC2C1O |
| InChI | InChI=1S/C9H13N4O7P/c10-7-4(8(11)15)13(2-12-7)9-5(14)6-3(19-9)1-18-21(16,17)20-6/h2-3,5-6,9,14H,1,10H2,(H2,11,15)(H,16,17) |
| InChIKey | HEVHEMVALSPJPT-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 172.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|