About 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine
9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine (PubChem CID 142815907) has the molecular formula C17H15F2N5O2S
and a molecular weight of 391.40 g/mol. Its IUPAC name is 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine.
Molecular Properties
| Compound Name | 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine |
| PubChem CID | 142815907 |
| Molecular Formula | C17H15F2N5O2S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine |
| SMILES | CC(F)/C(F)=C/Cn1cnc2c(SCc3ccc([N+](=O)[O-])cc3)ncnc21 |
| InChI | InChI=1S/C17H15F2N5O2S/c1-11(18)14(19)6-7-23-10-22-15-16(23)20-9-21-17(15)27-8-12-2-4-13(5-3-12)24(25)26/h2-6,9-11H,7-8H2,1H3/b14-6- |
| InChIKey | KOBMLTFSSWKKST-NSIKDUERSA-N |
| XLogP | 4.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine?
The IUPAC name of 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine (CID 142815907) is 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine.
What is the SMILES notation for 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine?
The canonical SMILES for 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine is CC(F)/C(F)=C/Cn1cnc2c(SCc3ccc([N+](=O)[O-])cc3)ncnc21.
What is the InChIKey of 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine?
The InChIKey is KOBMLTFSSWKKST-NSIKDUERSA-N. The full InChI is InChI=1S/C17H15F2N5O2S/c1-11(18)14(19)6-7-23-10-22-15-16(23)20-9-21-17(15)27-8-12-2-4-13(5-3-12)24(25)26/h2-6,9-11H,7-8H2,1H3/b14-6-.
What are the key properties of 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine?
9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine has a molecular weight of 391.40 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(Z)-3,4-difluoropent-2-enyl]-6-[(4-nitrophenyl)methylsulfanyl]purine is sourced from PubChem (CID 142815907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).