C12H10N6O2S — CID 43955309
3-methyl-7-[(3-nitrophenyl)methylsulfanyl]triazolo[4,5-d]pyrimidine (PubChem CID 43955309) has the molecular formula C12H10N6O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 3-methyl-7-[(3-nitrophenyl)methylsulfanyl]triazolo[4,5-d]pyrimidine.
| Compound Name | 3-methyl-7-[(3-nitrophenyl)methylsulfanyl]triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 43955309 |
| Molecular Formula | C12H10N6O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-methyl-7-[(3-nitrophenyl)methylsulfanyl]triazolo[4,5-d]pyrimidine |
| SMILES | Cn1nnc2c(SCc3cccc([N+](=O)[O-])c3)ncnc21 |
| InChI | InChI=1S/C12H10N6O2S/c1-17-11-10(15-16-17)12(14-7-13-11)21-6-8-3-2-4-9(5-8)18(19)20/h2-5,7H,6H2,1H3 |
| InChIKey | ISXOGOFNETZXHB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|