C18H19N5O5S — CID 46888765
(1S,2R,3R,5R)-3-(hydroxymethyl)-5-[6-[(3-nitrophenyl)methylsulfanyl]purin-9-yl]cyclopentane-1,2-diol (PubChem CID 46888765) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[6-[(3-nitrophenyl)methylsulfanyl]purin-9-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[6-[(3-nitrophenyl)methylsulfanyl]purin-9-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46888765 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[6-[(3-nitrophenyl)methylsulfanyl]purin-9-yl]cyclopentane-1,2-diol |
| SMILES | O=[N+]([O-])c1cccc(CSc2ncnc3c2ncn3[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C18H19N5O5S/c24-6-11-5-13(16(26)15(11)25)22-9-21-14-17(22)19-8-20-18(14)29-7-10-2-1-3-12(4-10)23(27)28/h1-4,8-9,11,13,15-16,24-26H,5-7H2/t11-,13-,15-,16+/m1/s1 |
| InChIKey | KRSIYGVWGKLPRH-CUBALJKWSA-N |
| XLogP | 1.30 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|