C22H26N6O5 — CID 139844038
(1S,2R,3S,5R)-3-(hydroxymethyl)-5-[6-[1-(4-nitrophenyl)piperidin-4-yl]purin-9-yl]cyclopentane-1,2-diol (PubChem CID 139844038) has the molecular formula C22H26N6O5 and a molecular weight of 454.49 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-(hydroxymethyl)-5-[6-[1-(4-nitrophenyl)piperidin-4-yl]purin-9-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-(hydroxymethyl)-5-[6-[1-(4-nitrophenyl)piperidin-4-yl]purin-9-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 139844038 |
| Molecular Formula | C22H26N6O5 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (1S,2R,3S,5R)-3-(hydroxymethyl)-5-[6-[1-(4-nitrophenyl)piperidin-4-yl]purin-9-yl]cyclopentane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(c3ncnc4c3ncn4[C@@H]3C[C@@H](CO)[C@@H](O)[C@H]3O)CC2)cc1 |
| InChI | InChI=1S/C22H26N6O5/c29-10-14-9-17(21(31)20(14)30)27-12-25-19-18(23-11-24-22(19)27)13-5-7-26(8-6-13)15-1-3-16(4-2-15)28(32)33/h1-4,11-14,17,20-21,29-31H,5-10H2/t14-,17+,20+,21-/m0/s1 |
| InChIKey | DMHIFBZSVNULFI-XVSRIUFKSA-N |
| XLogP | 1.39 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|