C17H15N5O7Se — CID 175676446
Se-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 4-nitrobenzenecarboselenoate (PubChem CID 175676446) has the molecular formula C17H15N5O7Se and a molecular weight of 480.30 g/mol. Its IUPAC name is Se-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 4-nitrobenzenecarboselenoate.
| Compound Name | Se-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 4-nitrobenzenecarboselenoate |
|---|---|
| PubChem CID | 175676446 |
| Molecular Formula | C17H15N5O7Se |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | Se-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl] 4-nitrobenzenecarboselenoate |
| SMILES | O=C([Se]c1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N5O7Se/c23-5-10-12(24)13(25)16(29-10)21-7-20-11-14(21)18-6-19-15(11)30-17(26)8-1-3-9(4-2-8)22(27)28/h1-4,6-7,10,12-13,16,23-25H,5H2/t10-,12-,13-,16-/m1/s1 |
| InChIKey | NXOJQBFJVRJMCG-XNIJJKJLSA-N |
| XLogP | -1.48 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|