C17H19N6O7+ — CID 10768253
(2R,3R,4S,5R)-2-[6-amino-1-[(4-nitrophenyl)methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10768253) has the molecular formula C17H19N6O7+ and a molecular weight of 419.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-1-[(4-nitrophenyl)methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-1-[(4-nitrophenyl)methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10768253 |
| Molecular Formula | C17H19N6O7+ |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-1-[(4-nitrophenyl)methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2nc[n+]1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N6O7/c18-15-12-16(21(7-19-12)17-14(26)13(25)11(5-24)30-17)20-8-22(15)29-6-9-1-3-10(4-2-9)23(27)28/h1-4,7-8,11,13-14,17-18,24-26H,5-6H2/p+1/t11-,13-,14-,17-/m1/s1 |
| InChIKey | JZQHFLNSTWTDHO-LSCFUAHRSA-O |
| XLogP | -1.55 |
| TPSA | 182.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|