C26H29N7O8 — CID 25096084
(4-nitrophenyl)methyl 4-[3-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 25096084) has the molecular formula C26H29N7O8 and a molecular weight of 567.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[3-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-[3-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25096084 |
| Molecular Formula | C26H29N7O8 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[3-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | Nc1nc(C#CCC2CCN(C(=O)OCc3ccc([N+](=O)[O-])cc3)CC2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H29N7O8/c27-23-20-24(32(14-28-20)25-22(36)21(35)18(12-34)41-25)30-19(29-23)3-1-2-15-8-10-31(11-9-15)26(37)40-13-16-4-6-17(7-5-16)33(38)39/h4-7,14-15,18,21-22,25,34-36H,2,8-13H2,(H2,27,29,30)/t18-,21-,22-,25-/m1/s1 |
| InChIKey | OFTORIBAXSTKLL-PXOHRUDZSA-N |
| XLogP | 0.72 |
| TPSA | 212.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|