C25H27N7O8 — CID 24872774
(4-nitrophenyl) 4-[3-[6-amino-9-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 24872774) has the molecular formula C25H27N7O8 and a molecular weight of 553.53 g/mol. Its IUPAC name is (4-nitrophenyl) 4-[3-[6-amino-9-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 4-[3-[6-amino-9-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24872774 |
| Molecular Formula | C25H27N7O8 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (4-nitrophenyl) 4-[3-[6-amino-9-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | Nc1nc(C#CCC2CCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)CC2)nc2c1ncn2C1OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H27N7O8/c26-22-19-23(31(13-27-19)24-21(35)20(34)17(12-33)40-24)29-18(28-22)3-1-2-14-8-10-30(11-9-14)25(36)39-16-6-4-15(5-7-16)32(37)38/h4-7,13-14,17,20-21,24,33-35H,2,8-12H2,(H2,26,28,29)/t17?,20-,21-,24?/m0/s1 |
| InChIKey | FRCLFHUVLOFHNL-UWUROIARSA-N |
| XLogP | 0.58 |
| TPSA | 212.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|