C19H18ClF6N5O9 — CID 10579607
(2R,3R,4S,5R)-2-[6-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol perchlorate (PubChem CID 10579607) has the molecular formula C19H18ClF6N5O9 and a molecular weight of 609.82 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol perchlorate.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol perchlorate |
|---|---|
| PubChem CID | 10579607 |
| Molecular Formula | C19H18ClF6N5O9 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]purin-1-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol perchlorate |
| SMILES | Nc1c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2nc[n+]1OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H17F6N5O5.ClHO4/c20-18(21,22)9-1-8(2-10(3-9)19(23,24)25)5-34-30-7-28-16-12(15(30)26)27-6-29(16)17-14(33)13(32)11(4-31)35-17;2-1(3,4)5/h1-3,6-7,11,13-14,17,26,31-33H,4-5H2;(H,2,3,4,5)/t11-,13-,14-,17-;/m1./s1 |
| InChIKey | FOFXWMXPBXNFIF-TZNCIMHNSA-N |
| XLogP | -4.18 |
| TPSA | 232.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|