C19H24ClN5O9 — CID 10625245
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)-1-[(2-methylphenyl)methoxy]purin-1-ium-9-yl]oxolane-3,4-diol perchlorate (PubChem CID 10625245) has the molecular formula C19H24ClN5O9 and a molecular weight of 501.88 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)-1-[(2-methylphenyl)methoxy]purin-1-ium-9-yl]oxolane-3,4-diol perchlorate.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)-1-[(2-methylphenyl)methoxy]purin-1-ium-9-yl]oxolane-3,4-diol perchlorate |
|---|---|
| PubChem CID | 10625245 |
| Molecular Formula | C19H24ClN5O9 |
| Molecular Weight | 501.88 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)-1-[(2-methylphenyl)methoxy]purin-1-ium-9-yl]oxolane-3,4-diol perchlorate |
| SMILES | CNc1c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2nc[n+]1OCc1ccccc1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H23N5O5.ClHO4/c1-11-5-3-4-6-12(11)8-28-24-10-22-18-14(17(24)20-2)21-9-23(18)19-16(27)15(26)13(7-25)29-19;2-1(3,4)5/h3-6,9-10,13,15-16,19,25-27H,7-8H2,1-2H3;(H,2,3,4,5)/t13-,15-,16-,19-;/m1./s1 |
| InChIKey | PGKUBKSSRDWNAT-ZPXBPYQOSA-N |
| XLogP | -5.45 |
| TPSA | 218.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.88 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|