C22H23N7O8 — CID 102337556
2-cyanoethyl N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethyl]purin-2-yl]carbamate (PubChem CID 102337556) has the molecular formula C22H23N7O8 and a molecular weight of 513.47 g/mol. Its IUPAC name is 2-cyanoethyl N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethyl]purin-2-yl]carbamate.
| Compound Name | 2-cyanoethyl N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethyl]purin-2-yl]carbamate |
|---|---|
| PubChem CID | 102337556 |
| Molecular Formula | C22H23N7O8 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 2-cyanoethyl N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethyl]purin-2-yl]carbamate |
| SMILES | N#CCCOC(=O)Nc1nc(CCc2ccc([N+](=O)[O-])cc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C22H23N7O8/c23-8-1-9-36-22(33)27-21-25-14(7-4-12-2-5-13(6-3-12)29(34)35)16-19(26-21)28(11-24-16)20-18(32)17(31)15(10-30)37-20/h2-3,5-6,11,15,17-18,20,30-32H,1,4,7,9-10H2,(H,25,26,27,33)/t15-,17-,18-,20-/m1/s1 |
| InChIKey | PUKSJWIBMVGTJD-DLVXIWMQSA-N |
| XLogP | 0.59 |
| TPSA | 218.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|