C25H24N6O8 — CID 175677260
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]benzamide (PubChem CID 175677260) has the molecular formula C25H24N6O8 and a molecular weight of 536.50 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]benzamide |
|---|---|
| PubChem CID | 175677260 |
| Molecular Formula | C25H24N6O8 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]benzamide |
| SMILES | O=C(Nc1nc(OCCc2ccc([N+](=O)[O-])cc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1)c1ccccc1 |
| InChI | InChI=1S/C25H24N6O8/c32-12-17-19(33)20(34)24(39-17)30-13-26-18-21(30)27-25(28-22(35)15-4-2-1-3-5-15)29-23(18)38-11-10-14-6-8-16(9-7-14)31(36)37/h1-9,13,17,19-20,24,32-34H,10-12H2,(H,27,28,29,35)/t17-,19-,20-,24-/m1/s1 |
| InChIKey | CRFBWNSZPCRDFC-AGFSROSKSA-N |
| XLogP | 1.22 |
| TPSA | 194.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|