C19H19IN6O7 — CID 14805368
2-(4-nitrophenyl)ethyl N-[9-[(2R,3S,4R,5R)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]purin-6-yl]carbamate (PubChem CID 14805368) has the molecular formula C19H19IN6O7 and a molecular weight of 570.30 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl N-[9-[(2R,3S,4R,5R)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | 2-(4-nitrophenyl)ethyl N-[9-[(2R,3S,4R,5R)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 14805368 |
| Molecular Formula | C19H19IN6O7 |
| Molecular Weight | 570.30 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl N-[9-[(2R,3S,4R,5R)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]purin-6-yl]carbamate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H](I)[C@H]1O)OCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19IN6O7/c20-13-12(7-27)33-18(15(13)28)25-9-23-14-16(21-8-22-17(14)25)24-19(29)32-6-5-10-1-3-11(4-2-10)26(30)31/h1-4,8-9,12-13,15,18,27-28H,5-7H2,(H,21,22,24,29)/t12-,13+,15-,18-/m1/s1 |
| InChIKey | SLWSDHDMUKXDFF-ZFHGCVPZSA-N |
| XLogP | 1.58 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|