C39H40N6O10 — CID 23257050
9H-fluoren-9-ylmethyl 6-[(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl]oxyhexanoate (PubChem CID 23257050) has the molecular formula C39H40N6O10 and a molecular weight of 752.78 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 6-[(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl]oxyhexanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 6-[(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl]oxyhexanoate |
|---|---|
| PubChem CID | 23257050 |
| Molecular Formula | C39H40N6O10 |
| Molecular Weight | 752.78 g/mol |
| Exact Mass | 752.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 6-[(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl]oxyhexanoate |
| SMILES | O=C(CCCCCO[C@H]1[C@@H](O)[C@H](n2cnc3c(NC(=O)OCCc4ccc([N+](=O)[O-])cc4)ncnc32)O[C@@H]1CO)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H40N6O10/c46-20-31-35(52-18-7-1-2-12-32(47)54-21-30-28-10-5-3-8-26(28)27-9-4-6-11-29(27)30)34(48)38(55-31)44-23-42-33-36(40-22-41-37(33)44)43-39(49)53-19-17-24-13-15-25(16-14-24)45(50)51/h3-6,8-11,13-16,22-23,30-31,34-35,38,46,48H,1-2,7,12,17-21H2,(H,40,41,43,49)/t31-,34-,35-,38-/m1/s1 |
| InChIKey | BGMKNPXNTGFKBQ-BBKOCAQVSA-N |
| XLogP | 5.08 |
| TPSA | 210.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|