C28H27N7O11 — CID 54281147
[(2R,3R,5S)-5-(hydroxymethyl)-2-[6-[2-(2-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl] 2-(2-nitrophenyl)ethyl carbonate (PubChem CID 54281147) has the molecular formula C28H27N7O11 and a molecular weight of 637.56 g/mol. Its IUPAC name is [(2R,3R,5S)-5-(hydroxymethyl)-2-[6-[2-(2-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl] 2-(2-nitrophenyl)ethyl carbonate.
| Compound Name | [(2R,3R,5S)-5-(hydroxymethyl)-2-[6-[2-(2-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl] 2-(2-nitrophenyl)ethyl carbonate |
|---|---|
| PubChem CID | 54281147 |
| Molecular Formula | C28H27N7O11 |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | [(2R,3R,5S)-5-(hydroxymethyl)-2-[6-[2-(2-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-3-yl] 2-(2-nitrophenyl)ethyl carbonate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1OC(=O)OCCc1ccccc1[N+](=O)[O-])OCCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H27N7O11/c36-14-19-13-22(46-28(38)44-12-10-18-6-2-4-8-21(18)35(41)42)26(45-19)33-16-31-23-24(29-15-30-25(23)33)32-27(37)43-11-9-17-5-1-3-7-20(17)34(39)40/h1-8,15-16,19,22,26,36H,9-14H2,(H,29,30,32,37)/t19-,22+,26+/m0/s1 |
| InChIKey | RQWLGXANXPYTKK-IATMXGELSA-N |
| XLogP | 3.48 |
| TPSA | 233.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|