C24H34N6O4Si — CID 58520484
9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-N-[(2-nitrophenyl)methyl]purin-6-amine (PubChem CID 58520484) has the molecular formula C24H34N6O4Si and a molecular weight of 498.66 g/mol. Its IUPAC name is 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-N-[(2-nitrophenyl)methyl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-N-[(2-nitrophenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 58520484 |
| Molecular Formula | C24H34N6O4Si |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-N-[(2-nitrophenyl)methyl]purin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4[N+](=O)[O-])ncnc32)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H34N6O4Si/c1-7-18-19(34-35(5,6)24(2,3)4)12-20(33-18)29-15-28-21-22(26-14-27-23(21)29)25-13-16-10-8-9-11-17(16)30(31)32/h8-11,14-15,18-20H,7,12-13H2,1-6H3,(H,25,26,27)/t18-,19?,20-/m1/s1 |
| InChIKey | OAYPQHKXHFAZRU-YSSMNDQQSA-N |
| XLogP | 5.43 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|