C43H50N6O6Si — CID 140822394
3-[[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]methyl]-1H-pyridin-2-one (PubChem CID 140822394) has the molecular formula C43H50N6O6Si and a molecular weight of 775.00 g/mol. Its IUPAC name is 3-[[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]methyl]-1H-pyridin-2-one.
| Compound Name | 3-[[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 140822394 |
| Molecular Formula | C43H50N6O6Si |
| Molecular Weight | 775.00 g/mol |
| Exact Mass | 774.36 |
| IUPAC Name | 3-[[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]methyl]-1H-pyridin-2-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NCc5ccc[nH]c5=O)ncnc43)C[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C43H50N6O6Si/c1-42(2,3)56(6,7)55-35-24-37(49-28-48-38-39(46-27-47-40(38)49)45-25-29-12-11-23-44-41(29)50)54-36(35)26-53-43(30-13-9-8-10-14-30,31-15-19-33(51-4)20-16-31)32-17-21-34(52-5)22-18-32/h8-23,27-28,35-37H,24-26H2,1-7H3,(H,44,50)(H,45,46,47)/t35-,36+,37+/m0/s1 |
| InChIKey | XTMXZKRJVOOUKO-HKIDPNTFSA-N |
| XLogP | 7.83 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.00 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|