C40H50N6O6Si — CID 140822380
2-[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]-N-methylacetamide (PubChem CID 140822380) has the molecular formula C40H50N6O6Si and a molecular weight of 738.96 g/mol. Its IUPAC name is 2-[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]-N-methylacetamide.
| Compound Name | 2-[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 140822380 |
| Molecular Formula | C40H50N6O6Si |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | 2-[[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]purin-6-yl]amino]-N-methylacetamide |
| SMILES | CNC(=O)CNc1ncnc2c1ncn2[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C40H50N6O6Si/c1-39(2,3)53(7,8)52-32-22-35(46-26-45-36-37(42-23-34(47)41-4)43-25-44-38(36)46)51-33(32)24-50-40(27-12-10-9-11-13-27,28-14-18-30(48-5)19-15-28)29-16-20-31(49-6)21-17-29/h9-21,25-26,32-33,35H,22-24H2,1-8H3,(H,41,47)(H,42,43,44)/t32-,33+,35+/m0/s1 |
| InChIKey | BYCDISCHHIUKNP-VUHKNJSWSA-N |
| XLogP | 6.69 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|